EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO3 |
| Net Charge | 0 |
| Average Mass | 299.370 |
| Monoisotopic Mass | 299.15214 |
| SMILES | [H][C@@]12CCC(=O)[C@]3(C)Oc4c(O)ccc5c4[C@]13CCN(C)[C@]2([H])C5 |
| InChI | InChI=1S/C18H21NO3/c1-17-14(21)6-4-11-12-9-10-3-5-13(20)16(22-17)15(10)18(11,17)7-8-19(12)2/h3,5,11-12,20H,4,6-9H2,1-2H3/t11-,12+,17-,18-/m0/s1 |
| InChIKey | NPZXCTIHHUUEEJ-CMKMFDCUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metopon (CHEBI:135267) is a morphinane alkaloid (CHEBI:25418) |
| metopon (CHEBI:135267) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 5-Methyldihydromorphinone | DrugCentral |
| IDS-NM-006 | ChEMBL |
| methyldihydromorphinone | DrugCentral |
| Metopon | ChEMBL |
| metopone | DrugCentral |
| metopon HCl | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1785 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:143-52-2 | DrugCentral |