EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O |
| Net Charge | 0 |
| Average Mass | 296.414 |
| Monoisotopic Mass | 296.18886 |
| SMILES | C[N+](C)([O-])CCCN1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C19H24N2O/c1-21(2,22)15-7-14-20-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)20/h3-6,8-11H,7,12-15H2,1-2H3 |
| InChIKey | QZIQORUGXBPDSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imipramine oxide (CHEBI:135256) has role antidepressant (CHEBI:35469) |
| imipramine oxide (CHEBI:135256) is a dibenzooxazepine (CHEBI:53802) |
| INN | Source |
|---|---|
| imipraminoxido | WHO MedNet |
| Synonyms | Source |
|---|---|
| imipramine n-oxide | DrugCentral |
| Imipramine oxide | ChEMBL |
| imipraminoxide | DrugCentral |
| imipraminoxide | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3295 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:6829-98-7 | DrugCentral |
| Citations |
|---|