EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16N2OS |
| Net Charge | 0 |
| Average Mass | 296.395 |
| Monoisotopic Mass | 296.09833 |
| SMILES | O=C1CN=C(c2ccccc2)c2c(sc3c2CCCC3)N1 |
| InChI | InChI=1S/C17H16N2OS/c20-14-10-18-16(11-6-2-1-3-7-11)15-12-8-4-5-9-13(12)21-17(15)19-14/h1-3,6-7H,4-5,8-10H2,(H,19,20) |
| InChIKey | AIZFEOPQVZBNGH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bentazepam (CHEBI:135252) has role anxiolytic drug (CHEBI:35474) |
| bentazepam (CHEBI:135252) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| bentazepam (CHEBI:135252) is a organosulfur heterocyclic compound (CHEBI:38106) |
| Synonyms | Source |
|---|---|
| Bentazepam | ChEMBL |
| bentazepam sulfate | DrugCentral |
| CI-718 | ChEMBL |
| thiadipone | DrugCentral |
| tiadipone | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 315 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:29462-18-8 | DrugCentral |
| Citations |
|---|