EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25NO2S |
| Net Charge | 0 |
| Average Mass | 295.448 |
| Monoisotopic Mass | 295.16060 |
| SMILES | CC(C)(C)NCC(O)COc1cccc2c1SCCC2 |
| InChI | InChI=1S/C16H25NO2S/c1-16(2,3)17-10-13(18)11-19-14-8-4-6-12-7-5-9-20-15(12)14/h4,6,8,13,17-18H,5,7,9-11H2,1-3H3 |
| InChIKey | HTWFXPCUFWKXOP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tertatolol (CHEBI:135244) has role cardiovascular drug (CHEBI:35554) |
| tertatolol (CHEBI:135244) is a thiochromane (CHEBI:50747) |
| Synonyms | Source |
|---|---|
| Artexal | ChEMBL |
| dl-Tertatolol | DrugCentral |
| Prenalex | ChEMBL |
| SE-2395 | ChEMBL |
| Tertatolol | ChEMBL |
| Tertatolol hydrochloride | ChEMBL |
| Brand Name | Source |
|---|---|
| Artex | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2605 | DrugCentral |
| HMDB0042026 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:83688-84-0 | DrugCentral |
| Citations |
|---|