EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO3 |
| Net Charge | 0 |
| Average Mass | 295.338 |
| Monoisotopic Mass | 295.12084 |
| SMILES | CCC(C(=O)O)c1ccc(N2Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H17NO3/c1-2-15(18(21)22)12-7-9-14(10-8-12)19-11-13-5-3-4-6-16(13)17(19)20/h3-10,15H,2,11H2,1H3,(H,21,22) |
| InChIKey | AYDXAULLCROVIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anticoagulant An agent that prevents blood clotting. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indobufen (CHEBI:135239) has role anti-arrhythmia drug (CHEBI:38070) |
| indobufen (CHEBI:135239) has role anticoagulant (CHEBI:50249) |
| indobufen (CHEBI:135239) is a isoindoles (CHEBI:24897) |
| INN | Source |
|---|---|
| indobufene | WHO MedNet |
| Synonyms | Source |
|---|---|
| ibustrin | DrugCentral |
| Indobufen | ChEMBL |
| K-2930 | ChEMBL |
| K 3920 | DrugCentral |
| K-3920 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1439 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:63610-08-2 | DrugCentral |
| Citations |
|---|