EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N3O6 |
| Net Charge | 0 |
| Average Mass | 295.251 |
| Monoisotopic Mass | 295.08044 |
| SMILES | [H][C@]1([C@@H](O)/C=N/NC(=O)c2ccncc2)OC(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H13N3O6/c16-7(10-8(17)9(18)12(20)21-10)5-14-15-11(19)6-1-3-13-4-2-6/h1-5,7-10,16-18H,(H,15,19)/b14-5+/t7-,8+,9-,10+/m0/s1 |
| InChIKey | ZBRCAASZBMWIDA-QFPUCQTMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyconiazide (CHEBI:135237) is a aromatic carboxylic acid (CHEBI:33859) |
| glyconiazide (CHEBI:135237) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| gluconiazide | DrugCentral |
| galatone | DrugCentral |
| mycobactyl | DrugCentral |
| gluronazide | DrugCentral |
| guidazide | DrugCentral |
| glucazide | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3270 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:3691-74-5 | DrugCentral |