EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2 |
| Net Charge | 0 |
| Average Mass | 294.442 |
| Monoisotopic Mass | 294.20960 |
| SMILES | CN(C)CCCN1c2ccccc2C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H26N2/c1-20(2)16-10-5-7-12-18(16)22(15-9-14-21(3)4)19-13-8-6-11-17(19)20/h5-8,10-13H,9,14-15H2,1-4H3 |
| InChIKey | RYQOGSFEJBUZBX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimetacrine (CHEBI:135233) has role antidepressant (CHEBI:35469) |
| dimetacrine (CHEBI:135233) is a acridines (CHEBI:22213) |
| INN | Source |
|---|---|
| dimetacrina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Dimetacrine | ChEMBL |
| dimetacrino | DrugCentral |
| dimetacrinum | DrugCentral |
| dimethacrin | DrugCentral |
| dimethacrine | DrugCentral |
| NSC-100297 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 902 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:4757-55-5 | DrugCentral |
| Citations |
|---|