EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N |
| Net Charge | 0 |
| Average Mass | 293.454 |
| Monoisotopic Mass | 293.21435 |
| SMILES | CC(CC1c2ccccc2CCc2ccccc21)CN(C)C |
| InChI | InChI=1S/C21H27N/c1-16(15-22(2)3)14-21-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)21/h4-11,16,21H,12-15H2,1-3H3 |
| InChIKey | ALELTFCQZDXAMQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butriptyline (CHEBI:135227) has role antidepressant (CHEBI:35469) |
| butriptyline (CHEBI:135227) is a organic tricyclic compound (CHEBI:51959) |
| INN | Source |
|---|---|
| butriptilina | WHO MedNet |
| Synonyms | Source |
|---|---|
| butriptylene | DrugCentral |
| Butriptyline | ChEMBL |
| butriptyline HCl | DrugCentral |
| butriptyline hydrochloride | DrugCentral |
| Brand Names | Source |
|---|---|
| Evadene | ChEMBL |
| Evadyne | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 455 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:35941-65-2 | DrugCentral |
| Citations |
|---|