EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 292.206 |
| Monoisotopic Mass | 291.07928 |
| SMILES | CC(C)(C)NCC(O)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H19Cl2NO2/c1-13(2,3)16-7-10(17)8-18-12-6-9(14)4-5-11(12)15/h4-6,10,16-17H,7-8H2,1-3H3 |
| InChIKey | XYCMOTOFHFTUIU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloranolol (CHEBI:135217) has role cardiovascular drug (CHEBI:35554) |
| cloranolol (CHEBI:135217) is a dichlorobenzene (CHEBI:23697) |
| Synonyms | Source |
|---|---|
| chloranolol | DrugCentral |
| Cloranolol | ChEMBL |
| tobanum | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 710 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:39563-28-5 | DrugCentral |