EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10ClNO4 |
| Net Charge | 0 |
| Average Mass | 291.690 |
| Monoisotopic Mass | 291.02984 |
| SMILES | O=C(O)c1ccccc1Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C14H10ClNO4/c15-8-5-6-10(14(19)20)12(7-8)16-11-4-2-1-3-9(11)13(17)18/h1-7,16H,(H,17,18)(H,19,20) |
| InChIKey | UGDPYGKWIHHBMB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lobenzarit (CHEBI:135215) is a aminobenzoic acid (CHEBI:22495) |
| INN | Source |
|---|---|
| lobenzarit | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| 1591 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:63329-53-3 | DrugCentral |
| Citations |
|---|