EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:135212 - befunolol
| Formula | C16H21NO4 |
| Net Charge | 0 |
| Average Mass | 291.347 |
| Monoisotopic Mass | 291.14706 |
| SMILES | CC(=O)c1cc2cccc(OCC(O)CNC(C)C)c2o1 |
| InChI | InChI=1S/C16H21NO4/c1-10(2)17-8-13(19)9-20-14-6-4-5-12-7-15(11(3)18)21-16(12)14/h4-7,10,13,17,19H,8-9H2,1-3H3 |
| InChIKey | ZPQPDBIHYCBNIG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| befunolol (CHEBI:135212) has role antiglaucoma drug (CHEBI:39456) |
| befunolol (CHEBI:135212) is a benzofurans (CHEBI:35259) |
| Synonyms | Source |
|---|---|
| Befunolol | ChEMBL |
| befunolol HCl | DrugCentral |
| befunolol hydrochloride | DrugCentral |
| bentos | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 295 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:39552-01-7 | DrugCentral |