EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20ClNO |
| Net Charge | 0 |
| Average Mass | 289.806 |
| Monoisotopic Mass | 289.12334 |
| SMILES | CN(C)CCC(O)(c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C17H20ClNO/c1-19(2)13-12-17(20,14-8-4-3-5-9-14)15-10-6-7-11-16(15)18/h3-11,20H,12-13H2,1-2H3 |
| InChIKey | WRCHFMBCVFFYEQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofedanol (CHEBI:135207) has role antitussive (CHEBI:51177) |
| clofedanol (CHEBI:135207) is a diarylmethane (CHEBI:51614) |
| clofedanol (CHEBI:135207) is a tertiary amino compound (CHEBI:50996) |
| clofedanol (CHEBI:135207) is conjugate base of clofedanol(1+) (CHEBI:187895) |
| Incoming Relation(s) |
| clofedanol(1+) (CHEBI:187895) is conjugate acid of clofedanol (CHEBI:135207) |
| IUPAC Name |
|---|
| 1-(2-chlorophenyl)-3-(dimethylamino)-1-phenylpropan-1-ol |
| INNs | Source |
|---|---|
| clofedanol | ChemIDplus |
| clofedanolum | ChEBI |
| clofedanol | WHO MedNet |
| clofédanol | WHO MedNet |
| Synonym | Source |
|---|---|
| chlophedianol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 585 | DrugCentral |
| DB04837 | DrugBank |
| CN101844989 | Patent |
| Clofedanol | Wikipedia |
| D07721 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2813922 | Reaxys |
| CAS:791-35-5 | DrugCentral |
| CAS:791-35-5 | ChemIDplus |
| Citations |
|---|