EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H31NO |
| Net Charge | 0 |
| Average Mass | 289.463 |
| Monoisotopic Mass | 289.24056 |
| SMILES | CN(C)CCCOC1(Cc2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C19H31NO/c1-20(2)15-10-16-21-19(13-8-3-4-9-14-19)17-18-11-6-5-7-12-18/h5-7,11-12H,3-4,8-10,13-17H2,1-2H3 |
| InChIKey | FYJJXENSONZJRG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bencyclane (CHEBI:135205) has role cardiovascular drug (CHEBI:35554) |
| bencyclane (CHEBI:135205) is a benzenes (CHEBI:22712) |
| INN | Source |
|---|---|
| benciclano | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bencyclane | ChEMBL |
| bencyclane fumarate | DrugCentral |
| benzcyclan | DrugCentral |
| benzcyclane | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 301 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:2179-37-5 | DrugCentral |