EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N2O2 |
| Net Charge | 0 |
| Average Mass | 288.391 |
| Monoisotopic Mass | 288.18378 |
| SMILES | CCN(CC)CCC1(c2ccccc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C17H24N2O2/c1-3-19(4-2)13-12-17(14-8-6-5-7-9-14)11-10-15(20)18-16(17)21/h5-9H,3-4,10-13H2,1-2H3,(H,18,20,21) |
| InChIKey | BFMBKRQFMIILCH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenglutarimide (CHEBI:135195) has role antiparkinson drug (CHEBI:48407) |
| phenglutarimide (CHEBI:135195) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| fenglutarimida | WHO MedNet |
| Synonyms | Source |
|---|---|
| phenglutarimid | DrugCentral |
| Phenglutarimide | ChEMBL |
| phenglutarimide HCl | DrugCentral |
| phenglutarimide hydrochloride | DrugCentral |
| phenylglutarimide | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2127 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1156-05-4 | DrugCentral |
| Citations |
|---|