EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O6S |
| Net Charge | 0 |
| Average Mass | 288.321 |
| Monoisotopic Mass | 288.06676 |
| SMILES | CCCOC(=O)c1sc(C(=O)OCCC)c(O)c1O |
| InChI | InChI=1S/C12H16O6S/c1-3-5-17-11(15)9-7(13)8(14)10(19-9)12(16)18-6-4-2/h13-14H,3-6H2,1-2H3 |
| InChIKey | GUFHWUFYAOUKTI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protiofate (CHEBI:135194) is a thiophenecarboxylic acid (CHEBI:48436) |
| Synonym | Source |
|---|---|
| protiofat | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3498 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:58416-00-5 | DrugCentral |