EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15Cl2N5 |
| Net Charge | 0 |
| Average Mass | 288.182 |
| Monoisotopic Mass | 287.07045 |
| SMILES | CC(C)NC(=N)NC(=N)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N5/c1-6(2)16-10(14)18-11(15)17-7-3-4-8(12)9(13)5-7/h3-6H,1-2H3,(H5,14,15,16,17,18) |
| InChIKey | ISZNZKHCRKXXAU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorproguanil (CHEBI:135192) has role antimalarial (CHEBI:38068) |
| chlorproguanil (CHEBI:135192) is a dichlorobenzene (CHEBI:23697) |
| INN | Source |
|---|---|
| clorproguanil | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chlorproguanil | ChEMBL |
| Proguanil hydrochloride related compound f | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 620 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:537-21-3 | DrugCentral |
| Citations |
|---|