EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3S |
| Net Charge | 0 |
| Average Mass | 285.416 |
| Monoisotopic Mass | 285.12997 |
| SMILES | CN(C)CCCN1c2ccccc2Sc2cccnc21 |
| InChI | InChI=1S/C16H19N3S/c1-18(2)11-6-12-19-13-7-3-4-8-14(13)20-15-9-5-10-17-16(15)19/h3-5,7-10H,6,11-12H2,1-2H3 |
| InChIKey | JTTAUPUMOLRVRA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prothipendyl (CHEBI:135182) has role antidepressant (CHEBI:35469) |
| prothipendyl (CHEBI:135182) has role antipsychotic agent (CHEBI:35476) |
| prothipendyl (CHEBI:135182) has role anxiolytic drug (CHEBI:35474) |
| prothipendyl (CHEBI:135182) is a aromatic amine (CHEBI:33860) |
| prothipendyl (CHEBI:135182) is a tertiary amino compound (CHEBI:50996) |
| INN | Source |
|---|---|
| protipendilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| dominal | DrugCentral |
| phrenotropin | DrugCentral |
| Prothipendyl | ChEMBL |
| prothipendyl HCl | DrugCentral |
| prothipendyl hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2315 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:303-69-5 | DrugCentral |
| Citations |
|---|