EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28N2 |
| Net Charge | 0 |
| Average Mass | 284.447 |
| Monoisotopic Mass | 284.22525 |
| SMILES | CN(C)CCCn1c2c(c3ccccc31)CCCCCC2 |
| InChI | InChI=1S/C19H28N2/c1-20(2)14-9-15-21-18-12-6-4-3-5-10-16(18)17-11-7-8-13-19(17)21/h7-8,11,13H,3-6,9-10,12,14-15H2,1-2H3 |
| InChIKey | PLIGPBGDXASWPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iprindole (CHEBI:135177) has role antidepressant (CHEBI:35469) |
| iprindole (CHEBI:135177) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| iprindol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Galatur | ChEMBL |
| Iprindole | ChEMBL |
| NSC-169449 | ChEMBL |
| pramindole | DrugCentral |
| Prondol | ChEMBL |
| Tertran | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1478 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:5560-72-5 | DrugCentral |
| Citations |
|---|