EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N2O3S |
| Net Charge | 0 |
| Average Mass | 284.381 |
| Monoisotopic Mass | 284.11946 |
| SMILES | CCOC(=O)C=C1SC(N2CCCCC2)C(=O)N1C |
| InChI | InChI=1S/C13H20N2O3S/c1-3-18-11(16)9-10-14(2)12(17)13(19-10)15-7-5-4-6-8-15/h9,13H,3-8H2,1-2H3 |
| InChIKey | ZCKKHYXUQFTBIK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etozolin (CHEBI:135174) has functional parent α-amino acid (CHEBI:33704) |
| etozolin (CHEBI:135174) has role cardiovascular drug (CHEBI:35554) |
| etozolin (CHEBI:135174) is a organonitrogen compound (CHEBI:35352) |
| etozolin (CHEBI:135174) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| etozolina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Elkapin | ChEMBL |
| (+/-)-Etozolin | DrugCentral |
| Etozolin | ChEMBL |
| etozoline | DrugCentral |
| (+/-)-Etozoline | DrugCentral |
| GO-687 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1114 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:73-09-6 | DrugCentral |
| Citations |
|---|