EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N4O9 |
| Net Charge | 0 |
| Average Mass | 284.181 |
| Monoisotopic Mass | 284.06043 |
| SMILES | O=[N+]([O-])OCCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-] |
| InChI | InChI=1S/C6H12N4O9/c11-8(12)17-4-1-7(2-5-18-9(13)14)3-6-19-10(15)16/h1-6H2 |
| InChIKey | HWKQNAWCHQMZHK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trolnitrate (CHEBI:135172) has role cardiovascular drug (CHEBI:35554) |
| trolnitrate (CHEBI:135172) is a nitrate ester (CHEBI:51080) |
| INN | Source |
|---|---|
| trolnitrato | WHO MedNet |
| Synonyms | Source |
|---|---|
| aminotrate | DrugCentral |
| etamin | DrugCentral |
| nitranole | DrugCentral |
| nitranolum | DrugCentral |
| nitretamine | DrugCentral |
| triethanolamine trinitrate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2770 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:7077-34-1 | DrugCentral |