EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N |
| Net Charge | 0 |
| Average Mass | 281.443 |
| Monoisotopic Mass | 281.21435 |
| SMILES | CC(CC(c1ccccc1)c1ccccc1)NC(C)(C)C |
| InChI | InChI=1S/C20H27N/c1-16(21-20(2,3)4)15-19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19,21H,15H2,1-4H3 |
| InChIKey | UISARWKNNNHPGI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | renal agent A drug used for its effect on the kidneys' regulation of body fluid composition and volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terodiline (CHEBI:135168) has role renal agent (CHEBI:35846) |
| terodiline (CHEBI:135168) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| terodilina | WHO MedNet |
| Synonyms | Source |
|---|---|
| dl-Terodiline | DrugCentral |
| Terodiline | ChEMBL |
| terodiline HCl | DrugCentral |
| terodiline hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2603 | DrugCentral |
| HMDB0240275 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:15793-40-5 | DrugCentral |
| Citations |
|---|