EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3O |
| Net Charge | 0 |
| Average Mass | 281.359 |
| Monoisotopic Mass | 281.15281 |
| SMILES | O=C(c1ccccn1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H19N3O/c21-17(16-8-4-5-9-18-16)20-12-10-19(11-13-20)14-15-6-2-1-3-7-15/h1-9H,10-14H2 |
| InChIKey | TZFUBYYADABEAV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piberaline (CHEBI:135167) is a aromatic carboxylic acid (CHEBI:33859) |
| piberaline (CHEBI:135167) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Manual Xrefs | Databases |
|---|---|
| 3466 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:39640-15-8 | DrugCentral |