EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28N2O2 |
| Net Charge | 0 |
| Average Mass | 280.412 |
| Monoisotopic Mass | 280.21508 |
| SMILES | CN(C)CCOCC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H28N2O2/c1-18(2)3-4-20-11-15(19)17-16-8-12-5-13(9-16)7-14(6-12)10-16/h12-14H,3-11H2,1-2H3,(H,17,19) |
| InChIKey | UXQDWARBDDDTKG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tromantadine (CHEBI:135163) has role antiviral agent (CHEBI:22587) |
| tromantadine (CHEBI:135163) is a secondary carboxamide (CHEBI:140325) |
| INN | Source |
|---|---|
| tromantadina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tromantadine | ChEMBL |
| tromantadine HCl | DrugCentral |
| tromantadine hydrochloride | DrugCentral |
| tromantadine monohydrochloride | DrugCentral |
| tromantidine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3634 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:53783-83-8 | DrugCentral |
| Citations |
|---|