EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N3O |
| Net Charge | 0 |
| Average Mass | 279.343 |
| Monoisotopic Mass | 279.13716 |
| SMILES | Cn1cc(C(=O)[C@@H]2CCc3ncnc3C2)c2ccccc21 |
| InChI | InChI=1S/C17H17N3O/c1-20-9-13(12-4-2-3-5-16(12)20)17(21)11-6-7-14-15(8-11)19-10-18-14/h2-5,9-11H,6-8H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | NTHPAPBPFQJABD-LLVKDONJSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ramosetron (CHEBI:135156) has role antiemetic (CHEBI:50919) |
| ramosetron (CHEBI:135156) has role antineoplastic agent (CHEBI:35610) |
| ramosetron (CHEBI:135156) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| ramosetron | WHO MedNet |
| Synonyms | Source |
|---|---|
| ibsetron | DrugCentral |
| ibsetron HCl | DrugCentral |
| ibsetron hydrochloride | DrugCentral |
| irribow | DrugCentral |
| ramosetron HCl | DrugCentral |
| ramosetron hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2357 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:132036-88-5 | DrugCentral |
| Citations |
|---|