EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9N3O5 |
| Net Charge | 0 |
| Average Mass | 275.220 |
| Monoisotopic Mass | 275.05422 |
| SMILES | O=C(N/N=C/c1ccc([N+](=O)[O-])o1)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H9N3O5/c16-9-3-1-8(2-4-9)12(17)14-13-7-10-5-6-11(20-10)15(18)19/h1-7,16H,(H,14,17)/b13-7+ |
| InChIKey | YCWSUKQGVSGXJO-NTUHNPAUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nifuroxazide (CHEBI:135136) is a benzoic acids (CHEBI:22723) |
| Synonyms | Source |
|---|---|
| nifuroxazid | DrugCentral |
| pentofuryl | DrugCentral |
| dicoferin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1928 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:965-52-6 | DrugCentral |