EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10AsNO5 |
| Net Charge | 0 |
| Average Mass | 275.092 |
| Monoisotopic Mass | 274.97749 |
| SMILES | CC(=O)Nc1cc([As](=O)(O)O)ccc1O |
| InChI | InChI=1S/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | ODFJOVXVLFUVNQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetarsol (CHEBI:135135) has role antileishmanial agent (CHEBI:70868) |
| acetarsol (CHEBI:135135) is a acetamides (CHEBI:22160) |
| acetarsol (CHEBI:135135) is a anilide (CHEBI:13248) |
| Synonyms | Source |
|---|---|
| Acetarsol | ChEMBL |
| acetarsone | ChEMBL |
| acetarsone | DrugCentral |
| acetphenarsine | DrugCentral |
| arsaphen | DrugCentral |
| NSC-13160 | ChEMBL |
| Brand Names | Source |
|---|---|
| Gynoplix | ChEMBL |
| S.v.c. | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 55 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:97-44-9 | DrugCentral |
| Citations |
|---|