EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N3 |
| Net Charge | 0 |
| Average Mass | 271.095 |
| Monoisotopic Mass | 270.99306 |
| SMILES | N=C(N)NCc1cccc([123I])c1 |
| InChI | InChI=1S/C8H10IN3/c9-7-3-1-2-6(4-7)5-12-8(10)11/h1-4H,5H2,(H4,10,11,12)/i9-4 |
| InChIKey | PDWUPXJEEYOOTR-IUAIQHPESA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iobenguane (123I) (CHEBI:135134) has role cardiovascular drug (CHEBI:35554) |
| iobenguane (123I) (CHEBI:135134) is a organoiodine compound (CHEBI:37142) |
| Synonyms | Source |
|---|---|
| 123i-metaiodobenzylguanidine | ChEMBL |
| 123i-mibg | ChEMBL |
| 3-iodobenzylguanidine (123i) | ChEMBL |
| Andreview | ChEMBL |
| iobenguane | DrugCentral |
| Iobenguane (123 i) | ChEMBL |
| Citations |
|---|