EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO4S2 |
| Net Charge | 0 |
| Average Mass | 273.335 |
| Monoisotopic Mass | 273.01295 |
| SMILES | CC(SC(=O)c1cccs1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | JNYSEDHQJCOWQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stepronin (CHEBI:135129) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| prostenoglycine | DrugCentral |
| stepronine lysine | DrugCentral |
| stepronine lysine salt | DrugCentral |
| stepronin monosodium | DrugCentral |
| stepronin monosodium salt | DrugCentral |
| stepronin sodium | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2479 | DrugCentral |
| HMDB0015492 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:72324-18-6 | DrugCentral |