EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18F3NO |
| Net Charge | 0 |
| Average Mass | 273.298 |
| Monoisotopic Mass | 273.13405 |
| SMILES | CC(C)N1CCOC(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H18F3NO/c1-10(2)18-6-7-19-13(9-18)11-4-3-5-12(8-11)14(15,16)17/h3-5,8,10,13H,6-7,9H2,1-2H3 |
| InChIKey | FVYUQFQCEOZYHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxaflozane (CHEBI:135128) has role antidepressant (CHEBI:35469) |
| oxaflozane (CHEBI:135128) is a morpholines (CHEBI:38785) |
| INN | Source |
|---|---|
| oxaflozano | WHO MedNet |
| Synonyms | Source |
|---|---|
| conflictan | DrugCentral |
| oxaflozan | DrugCentral |
| Oxaflozane | ChEMBL |
| oxaflozane HCl | DrugCentral |
| oxaflozane hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2007 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:26629-87-8 | DrugCentral |
| Citations |
|---|