EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N2O |
| Net Charge | 0 |
| Average Mass | 272.392 |
| Monoisotopic Mass | 272.18886 |
| SMILES | Cc1cccc(C)c1NC(=O)CC12CCCN1CCC2 |
| InChI | InChI=1S/C17H24N2O/c1-13-6-3-7-14(2)16(13)18-15(20)12-17-8-4-10-19(17)11-5-9-17/h3,6-7H,4-5,8-12H2,1-2H3,(H,18,20) |
| InChIKey | BCQTVJKBTWGHCX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pilsicainide (CHEBI:135127) has role anti-arrhythmia drug (CHEBI:38070) |
| pilsicainide (CHEBI:135127) has role sodium channel blocker (CHEBI:38633) |
| pilsicainide (CHEBI:135127) is a organic heterobicyclic compound (CHEBI:27171) |
| pilsicainide (CHEBI:135127) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-2-(tetrahydro-1H-pyrrolizin-7a(5H)-yl)acetamide |
| INNs | Source |
|---|---|
| pilsicainide | WHO MedNet |
| pilsicainida | WHO MedNet |
| pilsicaïnide | WHO MedNet |
| pilsicainidum | WHO MedNet |
| Synonym | Source |
|---|---|
| pilzicainide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2167 | DrugCentral |
| DB12712 | DrugBank |
| D08377 | KEGG DRUG |
| Pilsicainide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:88069-67-4 | ChemIDplus |
| Citations |
|---|