EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11Cl2N3O |
| Net Charge | 0 |
| Average Mass | 272.135 |
| Monoisotopic Mass | 271.02792 |
| SMILES | CC(c1ccc(Cl)c(Cl)c1)N1N=C(N)CC1=O |
| InChI | InChI=1S/C11H11Cl2N3O/c1-6(16-11(17)5-10(14)15-16)7-2-3-8(12)9(13)4-7/h2-4,6H,5H2,1H3,(H2,14,15) |
| InChIKey | RLWRMIYXDPXIEX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| muzolimine (CHEBI:135124) has role cardiovascular drug (CHEBI:35554) |
| muzolimine (CHEBI:135124) is a dichlorobenzene (CHEBI:23697) |
| INN | Source |
|---|---|
| muzolimina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bay G 2821 | DrugCentral |
| Bay-G-2821 | DrugCentral |
| BAY-G 2821 | ChEMBL |
| edrul | DrugCentral |
| Muzolimine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1858 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:55294-15-0 | DrugCentral |
| Citations |
|---|