EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22ClNO2 |
| Net Charge | 0 |
| Average Mass | 271.788 |
| Monoisotopic Mass | 271.13391 |
| SMILES | Cc1ccc(Cl)c(OCC(O)CNC(C)(C)C)c1 |
| InChI | InChI=1S/C14H22ClNO2/c1-10-5-6-12(15)13(7-10)18-9-11(17)8-16-14(2,3)4/h5-7,11,16-17H,8-9H2,1-4H3 |
| InChIKey | HQIRNZOQPUAHHV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bupranolol (CHEBI:135123) has role cardiovascular drug (CHEBI:35554) |
| bupranolol (CHEBI:135123) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| B 1312 FREE BASE | ChEMBL |
| B-1312 FREE BASE | ChEMBL |
| bupranol | DrugCentral |
| (+/-)-Bupranolol | DrugCentral |
| Bupranolol | ChEMBL |
| bupranolol HCl | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 433 | DrugCentral |
| HMDB0015697 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:14556-46-8 | DrugCentral |
| Citations |
|---|