EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO2 |
| Net Charge | 0 |
| Average Mass | 271.360 |
| Monoisotopic Mass | 271.15723 |
| SMILES | [H][C@@]12CCC[C@]3([H])Oc4c(O)ccc5c4[C@]13CCN(C)[C@]2([H])C5 |
| InChI | InChI=1S/C17H21NO2/c1-18-8-7-17-11-3-2-4-14(17)20-16-13(19)6-5-10(15(16)17)9-12(11)18/h5-6,11-12,14,19H,2-4,7-9H2,1H3/t11-,12+,14-,17+/m0/s1 |
| InChIKey | LNNWVNGFPYWNQE-GMIGKAJZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desomorphine (CHEBI:135119) is a morphinane alkaloid (CHEBI:25418) |
| Synonyms | Source |
|---|---|
| Dihydrodesoxymorphine D | DrugCentral |
| Deoxydihydromorphine D | DrugCentral |
| dihydroepoxymorphine | DrugCentral |
| Morphine D | DrugCentral |
| dihydrodeoxymorphine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3134 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:427-00-9 | DrugCentral |