EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO |
| Net Charge | 0 |
| Average Mass | 269.388 |
| Monoisotopic Mass | 269.17796 |
| SMILES | CC(COc1ccccc1)NC(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H23NO/c1-15(13-17-9-5-3-6-10-17)19-16(2)14-20-18-11-7-4-8-12-18/h3-12,15-16,19H,13-14H2,1-2H3 |
| InChIKey | URCIJDUOBBSMII-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextrofemine (CHEBI:135109) is a amphetamines (CHEBI:35338) |
| INNs | Source |
|---|---|
| dextrofemina | WHO MedNet |
| dextrofemine | WHO MedNet |
| Synonyms | Source |
|---|---|
| CB-3697 | ChEMBL |
| dextrofemine fumarate | DrugCentral |
| Racefemine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 840 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:15687-08-8 | DrugCentral |