EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11N3O9 |
| Net Charge | 0 |
| Average Mass | 269.166 |
| Monoisotopic Mass | 269.04953 |
| SMILES | CCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C6H11N3O9/c1-2-6(3-16-7(10)11,4-17-8(12)13)5-18-9(14)15/h2-5H2,1H3 |
| InChIKey | YZZCJYJBCUJISI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propatylnitrate (CHEBI:135104) has role cardiovascular drug (CHEBI:35554) |
| propatylnitrate (CHEBI:135104) is a nitrate ester (CHEBI:51080) |
| INN | Source |
|---|---|
| propatilnitrato | WHO MedNet |
| Synonyms | Source |
|---|---|
| etrynit | DrugCentral |
| ETT-N | ChEMBL |
| ETTN | ChEMBL |
| ettriol trinitrate | DrugCentral |
| propatyl nitrate | ChEMBL |
| propatyl nitrate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2295 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:2921-92-8 | DrugCentral |
| Citations |
|---|