EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N3O5 |
| Net Charge | 0 |
| Average Mass | 267.241 |
| Monoisotopic Mass | 267.08552 |
| SMILES | CCOC(=O)/C(=C/c1ncc([N+](=O)[O-])n1C)C(C)=O |
| InChI | InChI=1S/C11H13N3O5/c1-4-19-11(16)8(7(2)15)5-9-12-6-10(13(9)3)14(17)18/h5-6H,4H2,1-3H3/b8-5+ |
| InChIKey | GCHKUUOPYMFGEY-VMPITWQZSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propenidazole (CHEBI:135098) has role antiamoebic agent (CHEBI:171664) |
| propenidazole (CHEBI:135098) is a C-nitro compound (CHEBI:35716) |
| propenidazole (CHEBI:135098) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| propenidazol | WHO MedNet |
| Synonym | Source |
|---|---|
| Propenidazole | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4025 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:76448-31-2 | DrugCentral |