EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N4O2 |
| Net Charge | 0 |
| Average Mass | 264.329 |
| Monoisotopic Mass | 264.15863 |
| SMILES | CCCCCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C13H20N4O2/c1-4-5-6-7-8-17-12(18)10-11(14-9-15(10)2)16(3)13(17)19/h9H,4-8H2,1-3H3 |
| InChIKey | MRWQRJMESRRJJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentifylline (CHEBI:135091) has role cardiovascular drug (CHEBI:35554) |
| pentifylline (CHEBI:135091) is a oxopurine (CHEBI:25810) |
| INN | Source |
|---|---|
| pentifilina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-Hexyltheobromine | DrugCentral |
| hexyltheobromine | DrugCentral |
| Pentifylline | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2094 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1028-33-7 | DrugCentral |