EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O2 |
| Net Charge | 0 |
| Average Mass | 262.353 |
| Monoisotopic Mass | 262.16813 |
| SMILES | Cc1cc2c(OCC(O)CNC(C)C)cccc2n1 |
| InChI | InChI=1S/C15H22N2O2/c1-10(2)16-8-12(18)9-19-15-6-4-5-14-13(15)7-11(3)17-14/h4-7,10,12,16-18H,8-9H2,1-3H3 |
| InChIKey | NXWGWUVGUSFQJC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mepindolol (CHEBI:135082) has role cardiovascular drug (CHEBI:35554) |
| mepindolol (CHEBI:135082) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| betagon | DrugCentral |
| (+/-)-Mepindolol | DrugCentral |
| Mepindolol | ChEMBL |
| mepindolol sulfate | DrugCentral |
| mepindolol sulphate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1697 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:23694-81-7 | DrugCentral |
| Citations |
|---|