EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12ClNO2 |
| Net Charge | 0 |
| Average Mass | 261.708 |
| Monoisotopic Mass | 261.05566 |
| SMILES | Cc1ncc2c(c1O)COC2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClNO2/c1-8-13(17)12-7-18-14(11(12)6-16-8)9-2-4-10(15)5-3-9/h2-6,14,17H,7H2,1H3 |
| InChIKey | CVKNDPRBJVBDSS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cicletanine (CHEBI:135078) has role antihypertensive agent (CHEBI:35674) |
| cicletanine (CHEBI:135078) has role cardiovascular drug (CHEBI:35554) |
| cicletanine (CHEBI:135078) is a organochlorine compound (CHEBI:36683) |
| INN | Source |
|---|---|
| cicletanina | WHO MedNet |
| Synonyms | Source |
|---|---|
| (+/-)BN-1270 | ChEMBL |
| BN-1270 | ChEMBL |
| cicletanide | DrugCentral |
| (+/-)-Cicletanine | DrugCentral |
| Cicletanine | ChEMBL |
| cycletanide | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 634 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:89943-82-8 | DrugCentral |
| Citations |
|---|