EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N |
| Net Charge | 0 |
| Average Mass | 261.368 |
| Monoisotopic Mass | 261.15175 |
| SMILES | CN1CCC2=C(C1)c1ccccc1Cc1ccccc12 |
| InChI | InChI=1S/C19H19N/c1-20-11-10-18-16-8-4-2-6-14(16)12-15-7-3-5-9-17(15)19(18)13-20/h2-9H,10-13H2,1H3 |
| InChIKey | GVPIXRLYKVFFMK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| setiptiline (CHEBI:135076) has role serotonergic antagonist (CHEBI:48279) |
| setiptiline (CHEBI:135076) has role α-adrenergic antagonist (CHEBI:37890) |
| setiptiline (CHEBI:135076) is a tertiary amino compound (CHEBI:50996) |
| setiptiline (CHEBI:135076) is a tetracyclic antidepressant (CHEBI:50940) |
| setiptiline (CHEBI:135076) is conjugate base of setiptiline(1+) (CHEBI:176784) |
| Incoming Relation(s) |
| setiptiline(1+) (CHEBI:176784) is conjugate acid of setiptiline (CHEBI:135076) |
| IUPAC Name |
|---|
| 2-methyl-2,3,4,9-tetrahydro-1H-dibenzo[3,4:6,7]cyclohepta[1,2-c]pyridine |
| INNs | Source |
|---|---|
| setiptiline | WHO MedNet |
| setiptilinum | WHO MedNet |
| setiptilina | WHO MedNet |
| sétiptiline | WHO MedNet |
| Synonyms | Source |
|---|---|
| teciptilline | DrugCentral |
| Org-8282 | DrugCentral |
| MO 8282 | ChemIDplus |
| 2,3,4,9-tetrahydro-2-methyl-1H-dibenzo[3,4:6,7]cyclohepta[1,2-c]pyridine | ChemIDplus |
| MO-8282 | DrugBank |
| Org 8282 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2438 | DrugCentral |
| DB09304 | DrugBank |
| D08511 | KEGG DRUG |
| Setiptiline | Wikipedia |
| 5016 | ChemSpider |
| LSM-45982 | LINCS |
| CN101851201 | Patent |
| US2006039867 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1650422 | Reaxys |
| CAS:57262-94-9 | ChemIDplus |
| Citations |
|---|