EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N |
| Net Charge | 0 |
| Average Mass | 261.368 |
| Monoisotopic Mass | 261.15175 |
| SMILES | CN1CCC2=C(C1)c1ccccc1Cc1ccccc12 |
| InChI | InChI=1S/C19H19N/c1-20-11-10-18-16-8-4-2-6-14(16)12-15-7-3-5-9-17(15)19(18)13-20/h2-9H,10-13H2,1H3 |
| InChIKey | GVPIXRLYKVFFMK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| setiptiline (CHEBI:135076) has role serotonergic antagonist (CHEBI:48279) |
| setiptiline (CHEBI:135076) has role α-adrenergic antagonist (CHEBI:37890) |
| setiptiline (CHEBI:135076) is a tertiary amino compound (CHEBI:50996) |
| setiptiline (CHEBI:135076) is a tetracyclic antidepressant (CHEBI:50940) |
| setiptiline (CHEBI:135076) is conjugate base of setiptiline(1+) (CHEBI:176784) |
| Incoming Relation(s) |
| setiptiline(1+) (CHEBI:176784) is conjugate acid of setiptiline (CHEBI:135076) |
| IUPAC Name |
|---|
| 2-methyl-2,3,4,9-tetrahydro-1H-dibenzo[3,4:6,7]cyclohepta[1,2-c]pyridine |
| INNs | Source |
|---|---|
| setiptilina | WHO MedNet |
| setiptiline | WHO MedNet |
| sétiptiline | WHO MedNet |
| setiptilinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2,3,4,9-tetrahydro-2-methyl-1H-dibenzo[3,4:6,7]cyclohepta[1,2-c]pyridine | ChemIDplus |
| MO 8282 | ChemIDplus |
| MO-8282 | DrugBank |
| Org 8282 | DrugBank |
| Org-8282 | DrugCentral |
| teciptilline | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2438 | DrugCentral |
| 5016 | ChemSpider |
| CN101851201 | Patent |
| D08511 | KEGG DRUG |
| DB09304 | DrugBank |
| LSM-45982 | LINCS |
| Setiptiline | Wikipedia |
| US2006039867 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1650422 | Reaxys |
| CAS:57262-94-9 | ChemIDplus |
| Citations |
|---|