EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N4O |
| Net Charge | 0 |
| Average Mass | 260.341 |
| Monoisotopic Mass | 260.16371 |
| SMILES | CCN(CC)CCn1c(-c2ccccc2)noc1=N |
| InChI | InChI=1S/C14H20N4O/c1-3-17(4-2)10-11-18-13(16-19-14(18)15)12-8-6-5-7-9-12/h5-9,15H,3-4,10-11H2,1-2H3 |
| InChIKey | MGSPDRWOUCPKNZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imolamine (CHEBI:135072) has role cardiovascular drug (CHEBI:35554) |
| imolamine (CHEBI:135072) is a oxadiazole (CHEBI:46685) |
| imolamine (CHEBI:135072) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| imolamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Imolamine | ChEMBL |
| imolamine HCl | DrugCentral |
| imolamine hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1430 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:318-23-0 | DrugCentral |
| Citations |
|---|