EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18ClN |
| Net Charge | 0 |
| Average Mass | 259.780 |
| Monoisotopic Mass | 259.11278 |
| SMILES | C[C@@H](Cc1ccccc1)NCc1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN/c1-13(11-14-7-3-2-4-8-14)18-12-15-9-5-6-10-16(15)17/h2-10,13,18H,11-12H2,1H3/t13-/m0/s1 |
| InChIKey | LRXXRIXDSAEIOR-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clobenzorex (CHEBI:135069) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| clobenzorex HCl | DrugCentral |
| clobenzorex hydrochloride | DrugCentral |
| dinintel | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 684 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:13364-32-4 | DrugCentral |