EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19NO2 |
| Net Charge | 0 |
| Average Mass | 257.333 |
| Monoisotopic Mass | 257.14158 |
| SMILES | CN(C)CC(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C16H19NO2/c1-17(2)13-16(18-14-9-5-3-6-10-14)19-15-11-7-4-8-12-15/h3-12,16H,13H2,1-2H3 |
| InChIKey | QNMGHBMGNRQPNL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| medifoxamine (CHEBI:135061) has role antidepressant (CHEBI:35469) |
| medifoxamine (CHEBI:135061) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| medifoxamina | WHO MedNet |
| Synonym | Source |
|---|---|
| Medifoxamine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1656 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:32359-34-5 | DrugCentral |
| Citations |
|---|