EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O2 |
| Net Charge | 0 |
| Average Mass | 256.430 |
| Monoisotopic Mass | 256.24023 |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)O |
| InChI | InChI=1S/C16H32O2/c1-3-5-7-9-10-12-14-15(16(17)18)13-11-8-6-4-2/h15H,3-14H2,1-2H3,(H,17,18) |
| InChIKey | JMOLZNNXZPAGBH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexyldecanoic acid (CHEBI:135056) is a medium-chain fatty acid (CHEBI:59554) |
| Synonyms | Source |
|---|---|
| 2-Hexyldecanoic acid | DrugCentral |
| 2-n-Hexyldecanoic acid | DrugCentral |
| C16 Guerbet fatty acid | DrugCentral |
| Isocarb 16 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3278 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:25354-97-6 | DrugCentral |