EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22NO |
| Net Charge | +1 |
| Average Mass | 256.369 |
| Monoisotopic Mass | 256.16959 |
| SMILES | C[N+](C)(CCOc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H22NO/c1-18(2,15-16-9-5-3-6-10-16)13-14-19-17-11-7-4-8-12-17/h3-12H,13-15H2,1-2H3/q+1 |
| InChIKey | AVWWVJUMXRXPNF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bephenium (CHEBI:135055) has role anthelminthic drug (CHEBI:35443) |
| bephenium (CHEBI:135055) is a aromatic amine (CHEBI:33860) |
| Synonyms | Source |
|---|---|
| Bephenium | ChEMBL |
| bephenium hydroxynaphthoate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 340 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:7181-73-9 | DrugCentral |
| Citations |
|---|