EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O5 |
| Net Charge | 0 |
| Average Mass | 256.258 |
| Monoisotopic Mass | 256.10592 |
| SMILES | CCc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)nc1=O |
| InChI | InChI=1S/C11H16N2O5/c1-2-6-4-13(11(17)12-10(6)16)9-3-7(15)8(5-14)18-9/h4,7-9,14-15H,2-3,5H2,1H3,(H,12,16,17)/t7-,8+,9+/m0/s1 |
| InChIKey | XACKNLSZYYIACO-DJLDLDEBSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edoxudine (CHEBI:135051) has role antiviral agent (CHEBI:22587) |
| edoxudine (CHEBI:135051) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| INN | Source |
|---|---|
| edoxudina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-ethyl-3-(2'-deoxyribosyl)uracil | ChEMBL |
| Edoxudine | ChEMBL |
| epoxudine | DrugCentral |
| EUDR | ChEMBL |
| NSC-758405 | ChEMBL |
| ORF 15817 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3173 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:15176-29-1 | DrugCentral |
| Citations |
|---|