EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:135049 - cloforex
| Formula | C13H18ClNO2 |
| Net Charge | 0 |
| Average Mass | 255.745 |
| Monoisotopic Mass | 255.10261 |
| SMILES | CCOC(=O)NC(C)(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO2/c1-4-17-12(16)15-13(2,3)9-10-5-7-11(14)8-6-10/h5-8H,4,9H2,1-3H3,(H,15,16) |
| InChIKey | TZWKUQDQKPYNLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloforex (CHEBI:135049) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| clophorex | DrugCentral |
| frenapyl | DrugCentral |
| oberex | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 697 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:14261-75-7 | DrugCentral |