EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N |
| Net Charge | 0 |
| Average Mass | 255.405 |
| Monoisotopic Mass | 255.19870 |
| SMILES | [H][C@]12CCCC[C@]13CCN(C)[C@@]2([H])Cc1ccc(C)cc13 |
| InChI | InChI=1S/C18H25N/c1-13-6-7-14-12-17-15-5-3-4-8-18(15,16(14)11-13)9-10-19(17)2/h6-7,11,15,17H,3-5,8-10,12H2,1-2H3/t15-,17+,18+/m1/s1 |
| InChIKey | KBEZZLAAKIIPFK-NJAFHUGGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimemorfan (CHEBI:135048) is a morphinane alkaloid (CHEBI:25418) |
| Synonyms | Source |
|---|---|
| dimemorphan | DrugCentral |
| dimemorfan phosphate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 900 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:36309-01-0 | DrugCentral |