EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5N3O3S2 |
| Net Charge | 0 |
| Average Mass | 255.280 |
| Monoisotopic Mass | 254.97723 |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1cccs1 |
| InChI | InChI=1S/C8H5N3O3S2/c12-7(5-2-1-3-15-5)10-8-9-4-6(16-8)11(13)14/h1-4H,(H,9,10,12) |
| InChIKey | ZLOXYEZYWCTXHU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenonitrozole (CHEBI:135042) has role antiamoebic agent (CHEBI:171664) |
| tenonitrozole (CHEBI:135042) is a C-nitro compound (CHEBI:35716) |
| tenonitrozole (CHEBI:135042) is a 1,3-thiazoles (CHEBI:38418) |
| Synonyms | Source |
|---|---|
| atrican | DrugCentral |
| tenonitrozol | DrugCentral |
| Tenonitrozole | ChEMBL |
| thenitrazole | DrugCentral |
| thenitrazolum | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2594 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:3810-35-3 | DrugCentral |
| Citations |
|---|