EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:135022 - amfetaminil
| Formula | C17H18N2 |
| Net Charge | 0 |
| Average Mass | 250.345 |
| Monoisotopic Mass | 250.14700 |
| SMILES | CC(Cc1ccccc1)NC(C#N)c1ccccc1 |
| InChI | InChI=1S/C17H18N2/c1-14(12-15-8-4-2-5-9-15)19-17(13-18)16-10-6-3-7-11-16/h2-11,14,17,19H,12H2,1H3 |
| InChIKey | NFHVTCJKAHYEQN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amfetaminil (CHEBI:135022) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| amphetaminil | DrugCentral |
| aponeuron | DrugCentral |
| dl-Amphetaminil | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 196 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:17590-01-1 | DrugCentral |